C12H20F2N2O3 — CID 122015022
3-[(3,3-difluorocycloheptyl)methylcarbamoylamino]propanoic acid (PubChem CID 122015022) has the molecular formula C12H20F2N2O3 and a molecular weight of 278.30 g/mol. Its IUPAC name is 3-[(3,3-difluorocycloheptyl)methylcarbamoylamino]propanoic acid.
| Compound Name | 3-[(3,3-difluorocycloheptyl)methylcarbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 122015022 |
| Molecular Formula | C12H20F2N2O3 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 3-[(3,3-difluorocycloheptyl)methylcarbamoylamino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)NCC1CCCCC(F)(F)C1 |
| InChI | InChI=1S/C12H20F2N2O3/c13-12(14)5-2-1-3-9(7-12)8-16-11(19)15-6-4-10(17)18/h9H,1-8H2,(H,17,18)(H2,15,16,19) |
| InChIKey | RPPGJVZXOAXJGR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |