About 2-(1-hydroxyethyl)-4,5-dimethylcyclohexan-1-ol
2-(1-hydroxyethyl)-4,5-dimethylcyclohexan-1-ol (PubChem CID 23443116) has the molecular formula C10H20O2
and a molecular weight of 172.27 g/mol. Its IUPAC name is 2-(1-hydroxyethyl)-4,5-dimethylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 2-(1-hydroxyethyl)-4,5-dimethylcyclohexan-1-ol |
| PubChem CID | 23443116 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 2-(1-hydroxyethyl)-4,5-dimethylcyclohexan-1-ol |
| SMILES | CC(O)C1CC(C)C(C)CC1O |
| InChI | InChI=1S/C10H20O2/c1-6-4-9(8(3)11)10(12)5-7(6)2/h6-12H,4-5H2,1-3H3 |
| InChIKey | KOHGUMUXBXYMCZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1-hydroxyethyl)-4,5-dimethylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroxyethyl)-4,5-dimethylcyclohexan-1-ol?
The IUPAC name of 2-(1-hydroxyethyl)-4,5-dimethylcyclohexan-1-ol (CID 23443116) is 2-(1-hydroxyethyl)-4,5-dimethylcyclohexan-1-ol.
What is the SMILES notation for 2-(1-hydroxyethyl)-4,5-dimethylcyclohexan-1-ol?
The canonical SMILES for 2-(1-hydroxyethyl)-4,5-dimethylcyclohexan-1-ol is CC(O)C1CC(C)C(C)CC1O.
What is the InChIKey of 2-(1-hydroxyethyl)-4,5-dimethylcyclohexan-1-ol?
The InChIKey is KOHGUMUXBXYMCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2/c1-6-4-9(8(3)11)10(12)5-7(6)2/h6-12H,4-5H2,1-3H3.
What are the key properties of 2-(1-hydroxyethyl)-4,5-dimethylcyclohexan-1-ol?
2-(1-hydroxyethyl)-4,5-dimethylcyclohexan-1-ol has a molecular weight of 172.27 g/mol, XLogP of 1.41, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxyethyl)-4,5-dimethylcyclohexan-1-ol is sourced from PubChem (CID 23443116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).