C10H20O2 — CID 23443116
2-(1-hydroxyethyl)-4,5-dimethylcyclohexan-1-ol (PubChem CID 23443116) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is 2-(1-hydroxyethyl)-4,5-dimethylcyclohexan-1-ol.
| Compound Name | 2-(1-hydroxyethyl)-4,5-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 23443116 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 2-(1-hydroxyethyl)-4,5-dimethylcyclohexan-1-ol |
| SMILES | CC(O)C1CC(C)C(C)CC1O |
| InChI | InChI=1S/C10H20O2/c1-6-4-9(8(3)11)10(12)5-7(6)2/h6-12H,4-5H2,1-3H3 |
| InChIKey | KOHGUMUXBXYMCZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |