C14H27F — CID 175612345
1-(1-fluoroethyl)-2,3-di(propan-2-yl)cyclohexane (PubChem CID 175612345) has the molecular formula C14H27F and a molecular weight of 214.37 g/mol. Its IUPAC name is 1-(1-fluoroethyl)-2,3-di(propan-2-yl)cyclohexane.
| Compound Name | 1-(1-fluoroethyl)-2,3-di(propan-2-yl)cyclohexane |
|---|---|
| PubChem CID | 175612345 |
| Molecular Formula | C14H27F |
| Molecular Weight | 214.37 g/mol |
| Exact Mass | 214.21 |
| IUPAC Name | 1-(1-fluoroethyl)-2,3-di(propan-2-yl)cyclohexane |
| SMILES | CC(C)C1CCCC(C(C)F)C1C(C)C |
| InChI | InChI=1S/C14H27F/c1-9(2)12-7-6-8-13(11(5)15)14(12)10(3)4/h9-14H,6-8H2,1-5H3 |
| InChIKey | BEUZANYMEIFNGT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |