C9H17N — CID 171423027
(2R,3R)-2-cyclobutyl-3-propan-2-ylaziridine (PubChem CID 171423027) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is (2R,3R)-2-cyclobutyl-3-propan-2-ylaziridine.
| Compound Name | (2R,3R)-2-cyclobutyl-3-propan-2-ylaziridine |
|---|---|
| PubChem CID | 171423027 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | (2R,3R)-2-cyclobutyl-3-propan-2-ylaziridine |
| SMILES | CC(C)[C@H]1N[C@@H]1C1CCC1 |
| InChI | InChI=1S/C9H17N/c1-6(2)8-9(10-8)7-4-3-5-7/h6-10H,3-5H2,1-2H3/t8-,9-/m1/s1 |
| InChIKey | BUJPLALBJQFIBI-RKDXNWHRSA-N |
| XLogP | 1.78 |
| TPSA | 21.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|