C12H22O — CID 176780580
8-propan-2-yl-3,4,4a,5,6,7,8,8a-octahydro-2H-chromene (PubChem CID 176780580) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is 8-propan-2-yl-3,4,4a,5,6,7,8,8a-octahydro-2H-chromene.
| Compound Name | 8-propan-2-yl-3,4,4a,5,6,7,8,8a-octahydro-2H-chromene |
|---|---|
| PubChem CID | 176780580 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 8-propan-2-yl-3,4,4a,5,6,7,8,8a-octahydro-2H-chromene |
| SMILES | CC(C)C1CCCC2CCCOC21 |
| InChI | InChI=1S/C12H22O/c1-9(2)11-7-3-5-10-6-4-8-13-12(10)11/h9-12H,3-8H2,1-2H3 |
| InChIKey | GYHKMCQNEPYMCL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |