About (3-propan-2-yloxan-2-yl) acetate
(3-propan-2-yloxan-2-yl) acetate (PubChem CID 91983932) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is (3-propan-2-yloxan-2-yl) acetate.
Molecular Properties
| Compound Name | (3-propan-2-yloxan-2-yl) acetate |
| PubChem CID | 91983932 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (3-propan-2-yloxan-2-yl) acetate |
| SMILES | CC(=O)OC1OCCCC1C(C)C |
| InChI | InChI=1S/C10H18O3/c1-7(2)9-5-4-6-12-10(9)13-8(3)11/h7,9-10H,4-6H2,1-3H3 |
| InChIKey | XCAJIKBGFLQVCA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-propan-2-yloxan-2-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-propan-2-yloxan-2-yl) acetate?
The IUPAC name of (3-propan-2-yloxan-2-yl) acetate (CID 91983932) is (3-propan-2-yloxan-2-yl) acetate.
What is the SMILES notation for (3-propan-2-yloxan-2-yl) acetate?
The canonical SMILES for (3-propan-2-yloxan-2-yl) acetate is CC(=O)OC1OCCCC1C(C)C.
What is the InChIKey of (3-propan-2-yloxan-2-yl) acetate?
The InChIKey is XCAJIKBGFLQVCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-7(2)9-5-4-6-12-10(9)13-8(3)11/h7,9-10H,4-6H2,1-3H3.
What are the key properties of (3-propan-2-yloxan-2-yl) acetate?
(3-propan-2-yloxan-2-yl) acetate has a molecular weight of 186.25 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-propan-2-yloxan-2-yl) acetate is sourced from PubChem (CID 91983932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).