C13H27N2+ — CID 118546819
2,5-di(propan-2-yl)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrimidin-5-ium (PubChem CID 118546819) has the molecular formula C13H27N2+ and a molecular weight of 211.37 g/mol. Its IUPAC name is 2,5-di(propan-2-yl)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrimidin-5-ium.
| Compound Name | 2,5-di(propan-2-yl)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrimidin-5-ium |
|---|---|
| PubChem CID | 118546819 |
| Molecular Formula | C13H27N2+ |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.22 |
| IUPAC Name | 2,5-di(propan-2-yl)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrimidin-5-ium |
| SMILES | CC(C)C1CC[N+]2(C(C)C)CCCC2N1 |
| InChI | InChI=1S/C13H27N2/c1-10(2)12-7-9-15(11(3)4)8-5-6-13(15)14-12/h10-14H,5-9H2,1-4H3/q+1 |
| InChIKey | WMWBIJFPDMISKF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|