C10H20N+ — CID 90395187
4-propan-2-yl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium (PubChem CID 90395187) has the molecular formula C10H20N+ and a molecular weight of 154.28 g/mol. Its IUPAC name is 4-propan-2-yl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium.
| Compound Name | 4-propan-2-yl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium |
|---|---|
| PubChem CID | 90395187 |
| Molecular Formula | C10H20N+ |
| Molecular Weight | 154.28 g/mol |
| Exact Mass | 154.16 |
| IUPAC Name | 4-propan-2-yl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium |
| SMILES | CC(C)[N+]12CCCC1CCC2 |
| InChI | InChI=1S/C10H20N/c1-9(2)11-7-3-5-10(11)6-4-8-11/h9-10H,3-8H2,1-2H3/q+1 |
| InChIKey | QTLGZQMUCHNMIW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|