C12H29N5 — CID 10893941
trans-(2S,3S)-2,3-dimethyl-1,4,7,10,13-pentazacyclopentadecane (PubChem CID 10893941) has the molecular formula C12H29N5 and a molecular weight of 243.40 g/mol. Its IUPAC name is trans-(2S,3S)-2,3-dimethyl-1,4,7,10,13-pentazacyclopentadecane.
| Compound Name | trans-(2S,3S)-2,3-dimethyl-1,4,7,10,13-pentazacyclopentadecane |
|---|---|
| PubChem CID | 10893941 |
| Molecular Formula | C12H29N5 |
| Molecular Weight | 243.40 g/mol |
| Exact Mass | 243.24 |
| IUPAC Name | trans-(2S,3S)-2,3-dimethyl-1,4,7,10,13-pentazacyclopentadecane |
| SMILES | C[C@@H]1NCCNCCNCCNCCN[C@H]1C |
| InChI | InChI=1S/C12H29N5/c1-11-12(2)17-10-8-15-6-4-13-3-5-14-7-9-16-11/h11-17H,3-10H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | DIRJSUDUNBSTPL-RYUDHWBXSA-N |
| XLogP | -1.27 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.40 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |