C6H14N2O — CID 125425294
[(2S,3R)-3-methylpiperazin-2-yl]methanol (PubChem CID 125425294) has the molecular formula C6H14N2O and a molecular weight of 130.19 g/mol. Its IUPAC name is [(2S,3R)-3-methylpiperazin-2-yl]methanol.
| Compound Name | [(2S,3R)-3-methylpiperazin-2-yl]methanol |
|---|---|
| PubChem CID | 125425294 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | [(2S,3R)-3-methylpiperazin-2-yl]methanol |
| SMILES | C[C@H]1NCCN[C@@H]1CO |
| InChI | InChI=1S/C6H14N2O/c1-5-6(4-9)8-3-2-7-5/h5-9H,2-4H2,1H3/t5-,6-/m1/s1 |
| InChIKey | ZYUWLAQFHBFTFY-PHDIDXHHSA-N |
| XLogP | -1.07 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |