C6H11F3N2 — CID 138991310
(2S,3S)-2-methyl-3-(trifluoromethyl)piperazine (PubChem CID 138991310) has the molecular formula C6H11F3N2 and a molecular weight of 168.16 g/mol. Its IUPAC name is (2S,3S)-2-methyl-3-(trifluoromethyl)piperazine.
| Compound Name | (2S,3S)-2-methyl-3-(trifluoromethyl)piperazine |
|---|---|
| PubChem CID | 138991310 |
| Molecular Formula | C6H11F3N2 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | (2S,3S)-2-methyl-3-(trifluoromethyl)piperazine |
| SMILES | C[C@@H]1NCCN[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C6H11F3N2/c1-4-5(6(7,8)9)11-3-2-10-4/h4-5,10-11H,2-3H2,1H3/t4-,5-/m0/s1 |
| InChIKey | AUJABXPYMJQODY-WHFBIAKZSA-N |
| XLogP | 0.50 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |