About (2S,3R)-3-fluoro-2-(trifluoromethyl)piperidine;hydrochloride
(2S,3R)-3-fluoro-2-(trifluoromethyl)piperidine;hydrochloride (PubChem CID 162342228) has the molecular formula C6H10ClF4N
and a molecular weight of 207.60 g/mol. Its IUPAC name is (2S,3R)-3-fluoro-2-(trifluoromethyl)piperidine;hydrochloride.
Molecular Properties
| Compound Name | (2S,3R)-3-fluoro-2-(trifluoromethyl)piperidine;hydrochloride |
| PubChem CID | 162342228 |
| Molecular Formula | C6H10ClF4N |
| Molecular Weight | 207.60 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | (2S,3R)-3-fluoro-2-(trifluoromethyl)piperidine;hydrochloride |
| SMILES | Cl.F[C@@H]1CCCN[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C6H9F4N.ClH/c7-4-2-1-3-11-5(4)6(8,9)10;/h4-5,11H,1-3H2;1H/t4-,5+;/m1./s1 |
| InChIKey | VOSFCLRNALGDEU-JBUOLDKXSA-N |
| XLogP | 2.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.60 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S,3R)-3-fluoro-2-(trifluoromethyl)piperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-3-fluoro-2-(trifluoromethyl)piperidine;hydrochloride?
The IUPAC name of (2S,3R)-3-fluoro-2-(trifluoromethyl)piperidine;hydrochloride (CID 162342228) is (2S,3R)-3-fluoro-2-(trifluoromethyl)piperidine;hydrochloride.
What is the SMILES notation for (2S,3R)-3-fluoro-2-(trifluoromethyl)piperidine;hydrochloride?
The canonical SMILES for (2S,3R)-3-fluoro-2-(trifluoromethyl)piperidine;hydrochloride is Cl.F[C@@H]1CCCN[C@@H]1C(F)(F)F.
What is the InChIKey of (2S,3R)-3-fluoro-2-(trifluoromethyl)piperidine;hydrochloride?
The InChIKey is VOSFCLRNALGDEU-JBUOLDKXSA-N. The full InChI is InChI=1S/C6H9F4N.ClH/c7-4-2-1-3-11-5(4)6(8,9)10;/h4-5,11H,1-3H2;1H/t4-,5+;/m1./s1.
What are the key properties of (2S,3R)-3-fluoro-2-(trifluoromethyl)piperidine;hydrochloride?
(2S,3R)-3-fluoro-2-(trifluoromethyl)piperidine;hydrochloride has a molecular weight of 207.60 g/mol, XLogP of 2.06, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-3-fluoro-2-(trifluoromethyl)piperidine;hydrochloride is sourced from PubChem (CID 162342228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).