C12H20F3NO2 — CID 125457210
tert-butyl 2-[(2S,3R)-2-(trifluoromethyl)piperidin-3-yl]acetate (PubChem CID 125457210) has the molecular formula C12H20F3NO2 and a molecular weight of 267.29 g/mol. Its IUPAC name is tert-butyl 2-[(2S,3R)-2-(trifluoromethyl)piperidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[(2S,3R)-2-(trifluoromethyl)piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 125457210 |
| Molecular Formula | C12H20F3NO2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | tert-butyl 2-[(2S,3R)-2-(trifluoromethyl)piperidin-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@H]1CCCN[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C12H20F3NO2/c1-11(2,3)18-9(17)7-8-5-4-6-16-10(8)12(13,14)15/h8,10,16H,4-7H2,1-3H3/t8-,10+/m1/s1 |
| InChIKey | OBFGFDWQSFIXSK-SCZZXKLOSA-N |
| XLogP | 2.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |