C10H17F3N2O2 — CID 125455742
N-methoxy-N-methyl-2-[(2S,3R)-2-(trifluoromethyl)piperidin-3-yl]acetamide (PubChem CID 125455742) has the molecular formula C10H17F3N2O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is N-methoxy-N-methyl-2-[(2S,3R)-2-(trifluoromethyl)piperidin-3-yl]acetamide.
| Compound Name | N-methoxy-N-methyl-2-[(2S,3R)-2-(trifluoromethyl)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 125455742 |
| Molecular Formula | C10H17F3N2O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | N-methoxy-N-methyl-2-[(2S,3R)-2-(trifluoromethyl)piperidin-3-yl]acetamide |
| SMILES | CON(C)C(=O)C[C@H]1CCCN[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O2/c1-15(17-2)8(16)6-7-4-3-5-14-9(7)10(11,12)13/h7,9,14H,3-6H2,1-2H3/t7-,9+/m1/s1 |
| InChIKey | CXLNFOLAGFKKPR-APPZFPTMSA-N |
| XLogP | 1.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|