C8H16N2O4S — CID 80520093
2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-methoxy-N-methylacetamide (PubChem CID 80520093) has the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-methoxy-N-methylacetamide.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-methoxy-N-methylacetamide |
|---|---|
| PubChem CID | 80520093 |
| Molecular Formula | C8H16N2O4S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-methoxy-N-methylacetamide |
| SMILES | CON(C)C(=O)CC1CS(=O)(=O)CCN1 |
| InChI | InChI=1S/C8H16N2O4S/c1-10(14-2)8(11)5-7-6-15(12,13)4-3-9-7/h7,9H,3-6H2,1-2H3 |
| InChIKey | GQBXPVDVKYNHQK-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|