C6H11NO4S — CID 95970256
2-[(3R)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid (PubChem CID 95970256) has the molecular formula C6H11NO4S and a molecular weight of 193.22 g/mol. Its IUPAC name is 2-[(3R)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid.
| Compound Name | 2-[(3R)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid |
|---|---|
| PubChem CID | 95970256 |
| Molecular Formula | C6H11NO4S |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 2-[(3R)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1CS(=O)(=O)CCN1 |
| InChI | InChI=1S/C6H11NO4S/c8-6(9)3-5-4-12(10,11)2-1-7-5/h5,7H,1-4H2,(H,8,9)/t5-/m1/s1 |
| InChIKey | PCUGNWPHLMMPCS-RXMQYKEDSA-N |
| XLogP | -1.15 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |