C13H17NO3S — CID 116595361
1-(1,1-dioxo-1,4-thiazinan-3-yl)-3-phenylpropan-2-one (PubChem CID 116595361) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,4-thiazinan-3-yl)-3-phenylpropan-2-one.
| Compound Name | 1-(1,1-dioxo-1,4-thiazinan-3-yl)-3-phenylpropan-2-one |
|---|---|
| PubChem CID | 116595361 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 1-(1,1-dioxo-1,4-thiazinan-3-yl)-3-phenylpropan-2-one |
| SMILES | O=C(Cc1ccccc1)CC1CS(=O)(=O)CCN1 |
| InChI | InChI=1S/C13H17NO3S/c15-13(8-11-4-2-1-3-5-11)9-12-10-18(16,17)7-6-14-12/h1-5,12,14H,6-10H2 |
| InChIKey | JNXYWIBGVGMWJL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |