C10H19N3O3S — CID 80519969
2-(1,1-dioxo-1,4-thiazinan-3-yl)-1-piperazin-1-ylethanone (PubChem CID 80519969) has the molecular formula C10H19N3O3S and a molecular weight of 261.35 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-3-yl)-1-piperazin-1-ylethanone.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-1-piperazin-1-ylethanone |
|---|---|
| PubChem CID | 80519969 |
| Molecular Formula | C10H19N3O3S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-1-piperazin-1-ylethanone |
| SMILES | O=C(CC1CS(=O)(=O)CCN1)N1CCNCC1 |
| InChI | InChI=1S/C10H19N3O3S/c14-10(13-4-1-11-2-5-13)7-9-8-17(15,16)6-3-12-9/h9,11-12H,1-8H2 |
| InChIKey | BRHKKQKKRPDSRE-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |