C10H17N3O4S — CID 80519900
4-[2-(1,1-dioxo-1,4-thiazinan-3-yl)acetyl]piperazin-2-one (PubChem CID 80519900) has the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. Its IUPAC name is 4-[2-(1,1-dioxo-1,4-thiazinan-3-yl)acetyl]piperazin-2-one.
| Compound Name | 4-[2-(1,1-dioxo-1,4-thiazinan-3-yl)acetyl]piperazin-2-one |
|---|---|
| PubChem CID | 80519900 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 4-[2-(1,1-dioxo-1,4-thiazinan-3-yl)acetyl]piperazin-2-one |
| SMILES | O=C1CN(C(=O)CC2CS(=O)(=O)CCN2)CCN1 |
| InChI | InChI=1S/C10H17N3O4S/c14-9-6-13(3-1-12-9)10(15)5-8-7-18(16,17)4-2-11-8/h8,11H,1-7H2,(H,12,14) |
| InChIKey | ZWJWGEGWXPWKEP-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |