C11H17F3N2O4 — CID 71615144
(E)-N-methoxy-N-methyl-3-[(2S)-pyrrolidin-2-yl]prop-2-enamide;2,2,2-trifluoroacetic acid (PubChem CID 71615144) has the molecular formula C11H17F3N2O4 and a molecular weight of 298.26 g/mol. Its IUPAC name is (E)-N-methoxy-N-methyl-3-[(2S)-pyrrolidin-2-yl]prop-2-enamide;2,2,2-trifluoroacetic acid.
| Compound Name | (E)-N-methoxy-N-methyl-3-[(2S)-pyrrolidin-2-yl]prop-2-enamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 71615144 |
| Molecular Formula | C11H17F3N2O4 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (E)-N-methoxy-N-methyl-3-[(2S)-pyrrolidin-2-yl]prop-2-enamide;2,2,2-trifluoroacetic acid |
| SMILES | CON(C)C(=O)/C=C/[C@@H]1CCCN1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H16N2O2.C2HF3O2/c1-11(13-2)9(12)6-5-8-4-3-7-10-8;3-2(4,5)1(6)7/h5-6,8,10H,3-4,7H2,1-2H3;(H,6,7)/b6-5+;/t8-;/m0./s1 |
| InChIKey | PPUIKZKLQNXNAL-IUXUFCDKSA-N |
| XLogP | 0.95 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|