About tert-butyl carbamate;methanol;pyrrolidine-2-carbaldehyde
tert-butyl carbamate;methanol;pyrrolidine-2-carbaldehyde (PubChem CID 171093384) has the molecular formula C11H24N2O4
and a molecular weight of 248.32 g/mol. Its IUPAC name is tert-butyl carbamate;methanol;pyrrolidine-2-carbaldehyde.
Molecular Properties
| Compound Name | tert-butyl carbamate;methanol;pyrrolidine-2-carbaldehyde |
| PubChem CID | 171093384 |
| Molecular Formula | C11H24N2O4 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | tert-butyl carbamate;methanol;pyrrolidine-2-carbaldehyde |
| SMILES | CC(C)(C)OC(N)=O.CO.O=CC1CCCN1 |
| InChI | InChI=1S/C5H11NO2.C5H9NO.CH4O/c1-5(2,3)8-4(6)7;7-4-5-2-1-3-6-5;1-2/h1-3H3,(H2,6,7);4-6H,1-3H2;2H,1H3 |
| InChIKey | XQOBEEXCUYIEMN-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl carbamate;methanol;pyrrolidine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl carbamate;methanol;pyrrolidine-2-carbaldehyde?
The IUPAC name of tert-butyl carbamate;methanol;pyrrolidine-2-carbaldehyde (CID 171093384) is tert-butyl carbamate;methanol;pyrrolidine-2-carbaldehyde.
What is the SMILES notation for tert-butyl carbamate;methanol;pyrrolidine-2-carbaldehyde?
The canonical SMILES for tert-butyl carbamate;methanol;pyrrolidine-2-carbaldehyde is CC(C)(C)OC(N)=O.CO.O=CC1CCCN1.
What is the InChIKey of tert-butyl carbamate;methanol;pyrrolidine-2-carbaldehyde?
The InChIKey is XQOBEEXCUYIEMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.C5H9NO.CH4O/c1-5(2,3)8-4(6)7;7-4-5-2-1-3-6-5;1-2/h1-3H3,(H2,6,7);4-6H,1-3H2;2H,1H3.
What are the key properties of tert-butyl carbamate;methanol;pyrrolidine-2-carbaldehyde?
tert-butyl carbamate;methanol;pyrrolidine-2-carbaldehyde has a molecular weight of 248.32 g/mol, XLogP of 0.43, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl carbamate;methanol;pyrrolidine-2-carbaldehyde is sourced from PubChem (CID 171093384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).