C6H10F3N — CID 98041373
(2S,3S)-2-methyl-3-(trifluoromethyl)pyrrolidine (PubChem CID 98041373) has the molecular formula C6H10F3N and a molecular weight of 153.15 g/mol. Its IUPAC name is (2S,3S)-2-methyl-3-(trifluoromethyl)pyrrolidine.
| Compound Name | (2S,3S)-2-methyl-3-(trifluoromethyl)pyrrolidine |
|---|---|
| PubChem CID | 98041373 |
| Molecular Formula | C6H10F3N |
| Molecular Weight | 153.15 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | (2S,3S)-2-methyl-3-(trifluoromethyl)pyrrolidine |
| SMILES | C[C@@H]1NCC[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C6H10F3N/c1-4-5(2-3-10-4)6(7,8)9/h4-5,10H,2-3H2,1H3/t4-,5-/m0/s1 |
| InChIKey | QQXQZXDBICHVKM-WHFBIAKZSA-N |
| XLogP | 1.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.15 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |