C7H14F2N2 — CID 170771640
6-(difluoromethyl)-5-methyl-1,4-diazepane (PubChem CID 170771640) has the molecular formula C7H14F2N2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 6-(difluoromethyl)-5-methyl-1,4-diazepane.
| Compound Name | 6-(difluoromethyl)-5-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 170771640 |
| Molecular Formula | C7H14F2N2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 6-(difluoromethyl)-5-methyl-1,4-diazepane |
| SMILES | CC1NCCNCC1C(F)F |
| InChI | InChI=1S/C7H14F2N2/c1-5-6(7(8)9)4-10-2-3-11-5/h5-7,10-11H,2-4H2,1H3 |
| InChIKey | XJLFSENTSOAGSM-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |