C6H11IN2 — CID 167254767
6-iodo-3-methyl-2,6-diazabicyclo[3.2.0]heptane (PubChem CID 167254767) has the molecular formula C6H11IN2 and a molecular weight of 238.07 g/mol. Its IUPAC name is 6-iodo-3-methyl-2,6-diazabicyclo[3.2.0]heptane.
| Compound Name | 6-iodo-3-methyl-2,6-diazabicyclo[3.2.0]heptane |
|---|---|
| PubChem CID | 167254767 |
| Molecular Formula | C6H11IN2 |
| Molecular Weight | 238.07 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | 6-iodo-3-methyl-2,6-diazabicyclo[3.2.0]heptane |
| SMILES | CC1CC2C(CN2I)N1 |
| InChI | InChI=1S/C6H11IN2/c1-4-2-6-5(8-4)3-9(6)7/h4-6,8H,2-3H2,1H3 |
| InChIKey | ZZEUKEFHODMKBM-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.07 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|