C5H9IN2 — CID 143887791
(1R,5S)-6-iodo-3,6-diazabicyclo[3.2.0]heptane (PubChem CID 143887791) has the molecular formula C5H9IN2 and a molecular weight of 224.04 g/mol. Its IUPAC name is (1R,5S)-6-iodo-3,6-diazabicyclo[3.2.0]heptane.
| Compound Name | (1R,5S)-6-iodo-3,6-diazabicyclo[3.2.0]heptane |
|---|---|
| PubChem CID | 143887791 |
| Molecular Formula | C5H9IN2 |
| Molecular Weight | 224.04 g/mol |
| Exact Mass | 223.98 |
| IUPAC Name | (1R,5S)-6-iodo-3,6-diazabicyclo[3.2.0]heptane |
| SMILES | IN1C[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C5H9IN2/c6-8-3-4-1-7-2-5(4)8/h4-5,7H,1-3H2/t4-,5-/m1/s1 |
| InChIKey | FRFOEQATSYIKDL-RFZPGFLSSA-N |
| XLogP | 0.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.04 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|