C5H10IN3 — CID 155351202
6-iodo-3,6-diazabicyclo[3.2.0]heptan-3-amine (PubChem CID 155351202) has the molecular formula C5H10IN3 and a molecular weight of 239.06 g/mol. Its IUPAC name is 6-iodo-3,6-diazabicyclo[3.2.0]heptan-3-amine.
| Compound Name | 6-iodo-3,6-diazabicyclo[3.2.0]heptan-3-amine |
|---|---|
| PubChem CID | 155351202 |
| Molecular Formula | C5H10IN3 |
| Molecular Weight | 239.06 g/mol |
| Exact Mass | 238.99 |
| IUPAC Name | 6-iodo-3,6-diazabicyclo[3.2.0]heptan-3-amine |
| SMILES | NN1CC2CN(I)C2C1 |
| InChI | InChI=1S/C5H10IN3/c6-9-2-4-1-8(7)3-5(4)9/h4-5H,1-3,7H2 |
| InChIKey | RECUUGVCPTZNDY-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.06 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|