C8H17N3 — CID 145369428
3,3a,4,5,6,7,8,8a-octahydro-1H-pyrrolo[3,4-d]azepin-2-amine (PubChem CID 145369428) has the molecular formula C8H17N3 and a molecular weight of 155.24 g/mol. Its IUPAC name is 3,3a,4,5,6,7,8,8a-octahydro-1H-pyrrolo[3,4-d]azepin-2-amine.
| Compound Name | 3,3a,4,5,6,7,8,8a-octahydro-1H-pyrrolo[3,4-d]azepin-2-amine |
|---|---|
| PubChem CID | 145369428 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 3,3a,4,5,6,7,8,8a-octahydro-1H-pyrrolo[3,4-d]azepin-2-amine |
| SMILES | NN1CC2CCNCCC2C1 |
| InChI | InChI=1S/C8H17N3/c9-11-5-7-1-3-10-4-2-8(7)6-11/h7-8,10H,1-6,9H2 |
| InChIKey | IEGCPLLVYPDCRL-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|