C7H14N2O — CID 129410905
(3aR,7aR)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-amine (PubChem CID 129410905) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is (3aR,7aR)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-amine.
| Compound Name | (3aR,7aR)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-amine |
|---|---|
| PubChem CID | 129410905 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | (3aR,7aR)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-amine |
| SMILES | NN1CC[C@H]2COC[C@H]2C1 |
| InChI | InChI=1S/C7H14N2O/c8-9-2-1-6-4-10-5-7(6)3-9/h6-7H,1-5,8H2/t6-,7+/m0/s1 |
| InChIKey | WJNWQEVRNLNZKD-NKWVEPMBSA-N |
| XLogP | -0.17 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|