C15H29NO — CID 167466890
5-but-2-ynyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine;ethane (PubChem CID 167466890) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is 5-but-2-ynyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine;ethane.
| Compound Name | 5-but-2-ynyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine;ethane |
|---|---|
| PubChem CID | 167466890 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | 5-but-2-ynyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine;ethane |
| SMILES | CC.CC.CC#CCN1CCC2COCC2C1 |
| InChI | InChI=1S/C11H17NO.2C2H6/c1-2-3-5-12-6-4-10-8-13-9-11(10)7-12;2*1-2/h10-11H,4-9H2,1H3;2*1-2H3 |
| InChIKey | AEVQCAQAIHZBGW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|