C8H13NO2 — CID 115278376
(3R,4S)-1-but-2-ynylpyrrolidine-3,4-diol (PubChem CID 115278376) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (3R,4S)-1-but-2-ynylpyrrolidine-3,4-diol.
| Compound Name | (3R,4S)-1-but-2-ynylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 115278376 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (3R,4S)-1-but-2-ynylpyrrolidine-3,4-diol |
| SMILES | CC#CCN1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C8H13NO2/c1-2-3-4-9-5-7(10)8(11)6-9/h7-8,10-11H,4-6H2,1H3/t7-,8+ |
| InChIKey | IMNPXRYUIABCID-OCAPTIKFSA-N |
| XLogP | -0.95 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|