C12H22N2O — CID 129494852
(3aR,7aS)-5-piperidin-4-yl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine (PubChem CID 129494852) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is (3aR,7aS)-5-piperidin-4-yl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine.
| Compound Name | (3aR,7aS)-5-piperidin-4-yl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine |
|---|---|
| PubChem CID | 129494852 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | (3aR,7aS)-5-piperidin-4-yl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine |
| SMILES | C1CC(N2CC[C@@H]3COC[C@H]3C2)CCN1 |
| InChI | InChI=1S/C12H22N2O/c1-4-13-5-2-12(1)14-6-3-10-8-15-9-11(10)7-14/h10-13H,1-9H2/t10-,11-/m1/s1 |
| InChIKey | DXXJRGTUQMDICJ-GHMZBOCLSA-N |
| XLogP | 0.71 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |