C12H20N2O2 — CID 134789514
(4aS,9aR)-2-(oxetan-3-yl)-3,4,4a,5,7,8,9,9a-octahydro-1H-pyrido[3,4-d]azepin-6-one (PubChem CID 134789514) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is (4aS,9aR)-2-(oxetan-3-yl)-3,4,4a,5,7,8,9,9a-octahydro-1H-pyrido[3,4-d]azepin-6-one.
| Compound Name | (4aS,9aR)-2-(oxetan-3-yl)-3,4,4a,5,7,8,9,9a-octahydro-1H-pyrido[3,4-d]azepin-6-one |
|---|---|
| PubChem CID | 134789514 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | (4aS,9aR)-2-(oxetan-3-yl)-3,4,4a,5,7,8,9,9a-octahydro-1H-pyrido[3,4-d]azepin-6-one |
| SMILES | O=C1C[C@@H]2CCN(C3COC3)C[C@@H]2CCN1 |
| InChI | InChI=1S/C12H20N2O2/c15-12-5-9-2-4-14(11-7-16-8-11)6-10(9)1-3-13-12/h9-11H,1-8H2,(H,13,15)/t9-,10-/m0/s1 |
| InChIKey | CFEAFLYQPDECHA-UWVGGRQHSA-N |
| XLogP | 0.23 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |