C29H51N5O5 — CID 146116258
(1R,6R,11S,23S)-8-cyclopentyl-17,19-dihydroxy-25-propan-2-yl-3,8,14,22,25-pentazatricyclo[21.2.1.06,11]hexacosane-2,13,21-trione (PubChem CID 146116258) has the molecular formula C29H51N5O5 and a molecular weight of 549.76 g/mol. Its IUPAC name is (1R,6R,11S,23S)-8-cyclopentyl-17,19-dihydroxy-25-propan-2-yl-3,8,14,22,25-pentazatricyclo[21.2.1.06,11]hexacosane-2,13,21-trione.
| Compound Name | (1R,6R,11S,23S)-8-cyclopentyl-17,19-dihydroxy-25-propan-2-yl-3,8,14,22,25-pentazatricyclo[21.2.1.06,11]hexacosane-2,13,21-trione |
|---|---|
| PubChem CID | 146116258 |
| Molecular Formula | C29H51N5O5 |
| Molecular Weight | 549.76 g/mol |
| Exact Mass | 549.39 |
| IUPAC Name | (1R,6R,11S,23S)-8-cyclopentyl-17,19-dihydroxy-25-propan-2-yl-3,8,14,22,25-pentazatricyclo[21.2.1.06,11]hexacosane-2,13,21-trione |
| SMILES | CC(C)N1C[C@@H]2C[C@@H]1C(=O)NCC[C@H]1CN(C3CCCC3)CC[C@H]1CC(=O)NCCC(O)CC(O)CC(=O)N2 |
| InChI | InChI=1S/C29H51N5O5/c1-19(2)34-18-22-14-26(34)29(39)31-10-7-21-17-33(23-5-3-4-6-23)12-9-20(21)13-27(37)30-11-8-24(35)15-25(36)16-28(38)32-22/h19-26,35-36H,3-18H2,1-2H3,(H,30,37)(H,31,39)(H,32,38)/t20-,21-,22-,24?,25?,26+/m0/s1 |
| InChIKey | OOPUIQRRIJGLQX-GFJGGEIWSA-N |
| XLogP | 0.75 |
| TPSA | 134.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.76 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |