C32H51N5O6 — CID 146116257
(1R,6R,11S,23S)-17,19-dihydroxy-8-[(3-methoxyphenyl)methyl]-25-propan-2-yl-3,8,14,22,25-pentazatricyclo[21.2.1.06,11]hexacosane-2,13,21-trione (PubChem CID 146116257) has the molecular formula C32H51N5O6 and a molecular weight of 601.79 g/mol. Its IUPAC name is (1R,6R,11S,23S)-17,19-dihydroxy-8-[(3-methoxyphenyl)methyl]-25-propan-2-yl-3,8,14,22,25-pentazatricyclo[21.2.1.06,11]hexacosane-2,13,21-trione.
| Compound Name | (1R,6R,11S,23S)-17,19-dihydroxy-8-[(3-methoxyphenyl)methyl]-25-propan-2-yl-3,8,14,22,25-pentazatricyclo[21.2.1.06,11]hexacosane-2,13,21-trione |
|---|---|
| PubChem CID | 146116257 |
| Molecular Formula | C32H51N5O6 |
| Molecular Weight | 601.79 g/mol |
| Exact Mass | 601.38 |
| IUPAC Name | (1R,6R,11S,23S)-17,19-dihydroxy-8-[(3-methoxyphenyl)methyl]-25-propan-2-yl-3,8,14,22,25-pentazatricyclo[21.2.1.06,11]hexacosane-2,13,21-trione |
| SMILES | COc1cccc(CN2CC[C@H]3CC(=O)NCCC(O)CC(O)CC(=O)N[C@H]4C[C@H](C(=O)NCC[C@H]3C2)N(C(C)C)C4)c1 |
| InChI | InChI=1S/C32H51N5O6/c1-21(2)37-20-25-15-29(37)32(42)34-10-7-24-19-36(18-22-5-4-6-28(13-22)43-3)12-9-23(24)14-30(40)33-11-8-26(38)16-27(39)17-31(41)35-25/h4-6,13,21,23-27,29,38-39H,7-12,14-20H2,1-3H3,(H,33,40)(H,34,42)(H,35,41)/t23-,24-,25-,26?,27?,29+/m0/s1 |
| InChIKey | BUAFEYAOHSAAGP-XSUVEBPOSA-N |
| XLogP | 1.02 |
| TPSA | 143.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.79 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |