C30H47N5O5 — CID 154813533
(1R,11S,12S,16S)-11-hydroxy-1'-[(3-methoxyphenyl)methyl]-12,19-dimethylspiro[4,8,13,19-tetrazabicyclo[14.4.0]icosane-7,4'-piperidine]-5,9,14-trione (PubChem CID 154813533) has the molecular formula C30H47N5O5 and a molecular weight of 557.74 g/mol. Its IUPAC name is (1R,11S,12S,16S)-11-hydroxy-1'-[(3-methoxyphenyl)methyl]-12,19-dimethylspiro[4,8,13,19-tetrazabicyclo[14.4.0]icosane-7,4'-piperidine]-5,9,14-trione.
| Compound Name | (1R,11S,12S,16S)-11-hydroxy-1'-[(3-methoxyphenyl)methyl]-12,19-dimethylspiro[4,8,13,19-tetrazabicyclo[14.4.0]icosane-7,4'-piperidine]-5,9,14-trione |
|---|---|
| PubChem CID | 154813533 |
| Molecular Formula | C30H47N5O5 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.36 |
| IUPAC Name | (1R,11S,12S,16S)-11-hydroxy-1'-[(3-methoxyphenyl)methyl]-12,19-dimethylspiro[4,8,13,19-tetrazabicyclo[14.4.0]icosane-7,4'-piperidine]-5,9,14-trione |
| SMILES | COc1cccc(CN2CCC3(CC2)CC(=O)NCC[C@H]2CN(C)CC[C@H]2CC(=O)N[C@@H](C)[C@@H](O)CC(=O)N3)c1 |
| InChI | InChI=1S/C30H47N5O5/c1-21-26(36)17-28(38)33-30(9-13-35(14-10-30)19-22-5-4-6-25(15-22)40-3)18-29(39)31-11-7-24-20-34(2)12-8-23(24)16-27(37)32-21/h4-6,15,21,23-24,26,36H,7-14,16-20H2,1-3H3,(H,31,39)(H,32,37)(H,33,38)/t21-,23-,24-,26-/m0/s1 |
| InChIKey | UZESUCMDCPCZBU-KYFHRZRWSA-N |
| XLogP | 1.27 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |