C34H51F2N5O6 — CID 146116896
(1R,6R,11S,24R)-26-(4,4-difluorocyclohexyl)-8-[(3-methoxyphenyl)methyl]-17,20-dioxa-3,8,14,23,26-pentazatricyclo[22.2.1.06,11]heptacosane-2,13,22-trione (PubChem CID 146116896) has the molecular formula C34H51F2N5O6 and a molecular weight of 663.81 g/mol. Its IUPAC name is (1R,6R,11S,24R)-26-(4,4-difluorocyclohexyl)-8-[(3-methoxyphenyl)methyl]-17,20-dioxa-3,8,14,23,26-pentazatricyclo[22.2.1.06,11]heptacosane-2,13,22-trione.
| Compound Name | (1R,6R,11S,24R)-26-(4,4-difluorocyclohexyl)-8-[(3-methoxyphenyl)methyl]-17,20-dioxa-3,8,14,23,26-pentazatricyclo[22.2.1.06,11]heptacosane-2,13,22-trione |
|---|---|
| PubChem CID | 146116896 |
| Molecular Formula | C34H51F2N5O6 |
| Molecular Weight | 663.81 g/mol |
| Exact Mass | 663.38 |
| IUPAC Name | (1R,6R,11S,24R)-26-(4,4-difluorocyclohexyl)-8-[(3-methoxyphenyl)methyl]-17,20-dioxa-3,8,14,23,26-pentazatricyclo[22.2.1.06,11]heptacosane-2,13,22-trione |
| SMILES | COc1cccc(CN2CC[C@H]3CC(=O)NCCOCCOCC(=O)N[C@@H]4C[C@H](C(=O)NCC[C@H]3C2)N(C2CCC(F)(F)CC2)C4)c1 |
| InChI | InChI=1S/C34H51F2N5O6/c1-45-29-4-2-3-24(17-29)20-40-13-8-25-18-31(42)37-12-14-46-15-16-47-23-32(43)39-27-19-30(33(44)38-11-7-26(25)21-40)41(22-27)28-5-9-34(35,36)10-6-28/h2-4,17,25-28,30H,5-16,18-23H2,1H3,(H,37,42)(H,38,44)(H,39,43)/t25-,26-,27+,30+/m0/s1 |
| InChIKey | AOTROPNFMFGJDS-NVIJWRNBSA-N |
| XLogP | 2.33 |
| TPSA | 121.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.81 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |