C35H55N5O7 — CID 146116601
(1S,20R)-1'-(3,3-dimethylbutanoyl)-22-[(2-hydroxyphenyl)methyl]spiro[7,10-dioxa-4,13,17,22-tetrazabicyclo[18.4.0]tetracosane-14,4'-piperidine]-3,12,16-trione (PubChem CID 146116601) has the molecular formula C35H55N5O7 and a molecular weight of 657.85 g/mol. Its IUPAC name is (1S,20R)-1'-(3,3-dimethylbutanoyl)-22-[(2-hydroxyphenyl)methyl]spiro[7,10-dioxa-4,13,17,22-tetrazabicyclo[18.4.0]tetracosane-14,4'-piperidine]-3,12,16-trione.
| Compound Name | (1S,20R)-1'-(3,3-dimethylbutanoyl)-22-[(2-hydroxyphenyl)methyl]spiro[7,10-dioxa-4,13,17,22-tetrazabicyclo[18.4.0]tetracosane-14,4'-piperidine]-3,12,16-trione |
|---|---|
| PubChem CID | 146116601 |
| Molecular Formula | C35H55N5O7 |
| Molecular Weight | 657.85 g/mol |
| Exact Mass | 657.41 |
| IUPAC Name | (1S,20R)-1'-(3,3-dimethylbutanoyl)-22-[(2-hydroxyphenyl)methyl]spiro[7,10-dioxa-4,13,17,22-tetrazabicyclo[18.4.0]tetracosane-14,4'-piperidine]-3,12,16-trione |
| SMILES | CC(C)(C)CC(=O)N1CCC2(CC1)CC(=O)NCC[C@H]1CN(Cc3ccccc3O)CC[C@H]1CC(=O)NCCOCCOCC(=O)N2 |
| InChI | InChI=1S/C35H55N5O7/c1-34(2,3)22-33(45)40-15-10-35(11-16-40)21-31(43)36-12-8-27-23-39(24-28-6-4-5-7-29(28)41)14-9-26(27)20-30(42)37-13-17-46-18-19-47-25-32(44)38-35/h4-7,26-27,41H,8-25H2,1-3H3,(H,36,43)(H,37,42)(H,38,44)/t26-,27-/m0/s1 |
| InChIKey | VHTJXWSOSMQYHE-SVBPBHIXSA-N |
| XLogP | 2.19 |
| TPSA | 149.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.85 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|