C35H52N6O5 — CID 146116795
(16R)-1'-(3,3-dimethylbutanoyl)-15-[(2-hydroxyphenyl)methyl]spiro[2,8,12,15,18-pentazatetracyclo[16.2.2.112,16.02,6]tricosane-9,4'-piperidine]-7,11,17-trione (PubChem CID 146116795) has the molecular formula C35H52N6O5 and a molecular weight of 636.84 g/mol. Its IUPAC name is (16R)-1'-(3,3-dimethylbutanoyl)-15-[(2-hydroxyphenyl)methyl]spiro[2,8,12,15,18-pentazatetracyclo[16.2.2.112,16.02,6]tricosane-9,4'-piperidine]-7,11,17-trione.
| Compound Name | (16R)-1'-(3,3-dimethylbutanoyl)-15-[(2-hydroxyphenyl)methyl]spiro[2,8,12,15,18-pentazatetracyclo[16.2.2.112,16.02,6]tricosane-9,4'-piperidine]-7,11,17-trione |
|---|---|
| PubChem CID | 146116795 |
| Molecular Formula | C35H52N6O5 |
| Molecular Weight | 636.84 g/mol |
| Exact Mass | 636.40 |
| IUPAC Name | (16R)-1'-(3,3-dimethylbutanoyl)-15-[(2-hydroxyphenyl)methyl]spiro[2,8,12,15,18-pentazatetracyclo[16.2.2.112,16.02,6]tricosane-9,4'-piperidine]-7,11,17-trione |
| SMILES | CC(C)(C)CC(=O)N1CCC2(CC1)CC(=O)N1CCN(Cc3ccccc3O)[C@H](C1)C(=O)N1CCC(CC1)N1CCCC1C(=O)N2 |
| InChI | InChI=1S/C35H52N6O5/c1-34(2,3)21-30(43)37-17-12-35(13-18-37)22-31(44)40-20-19-39(23-25-7-4-5-9-29(25)42)28(24-40)33(46)38-15-10-26(11-16-38)41-14-6-8-27(41)32(45)36-35/h4-5,7,9,26-28,42H,6,8,10-24H2,1-3H3,(H,36,45)/t27?,28-/m1/s1 |
| InChIKey | FJXOKUAFTABSPO-PLYLYKGUSA-N |
| XLogP | 2.18 |
| TPSA | 116.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.84 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|