C32H49N5O4 — CID 154813804
(5S)-5-(cyclopentylamino)-1'-(3,3-dimethylbutanoyl)spiro[3,9,13-triazabicyclo[14.4.0]icosa-1(20),16,18-triene-12,4'-piperidine]-4,10,14-trione (PubChem CID 154813804) has the molecular formula C32H49N5O4 and a molecular weight of 567.78 g/mol. Its IUPAC name is (5S)-5-(cyclopentylamino)-1'-(3,3-dimethylbutanoyl)spiro[3,9,13-triazabicyclo[14.4.0]icosa-1(20),16,18-triene-12,4'-piperidine]-4,10,14-trione.
| Compound Name | (5S)-5-(cyclopentylamino)-1'-(3,3-dimethylbutanoyl)spiro[3,9,13-triazabicyclo[14.4.0]icosa-1(20),16,18-triene-12,4'-piperidine]-4,10,14-trione |
|---|---|
| PubChem CID | 154813804 |
| Molecular Formula | C32H49N5O4 |
| Molecular Weight | 567.78 g/mol |
| Exact Mass | 567.38 |
| IUPAC Name | (5S)-5-(cyclopentylamino)-1'-(3,3-dimethylbutanoyl)spiro[3,9,13-triazabicyclo[14.4.0]icosa-1(20),16,18-triene-12,4'-piperidine]-4,10,14-trione |
| SMILES | CC(C)(C)CC(=O)N1CCC2(CC1)CC(=O)NCCC[C@H](NC1CCCC1)C(=O)NCc1ccccc1CC(=O)N2 |
| InChI | InChI=1S/C32H49N5O4/c1-31(2,3)21-29(40)37-17-14-32(15-18-37)20-28(39)33-16-8-13-26(35-25-11-6-7-12-25)30(41)34-22-24-10-5-4-9-23(24)19-27(38)36-32/h4-5,9-10,25-26,35H,6-8,11-22H2,1-3H3,(H,33,39)(H,34,41)(H,36,38)/t26-/m0/s1 |
| InChIKey | SFMQPZYICUNVFQ-SANMLTNESA-N |
| XLogP | 2.96 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.78 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |