C15H20N2O — CID 3844156
3-(2,3-dihydro-1H-inden-2-ylamino)azepan-2-one (PubChem CID 3844156) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-2-ylamino)azepan-2-one.
| Compound Name | 3-(2,3-dihydro-1H-inden-2-ylamino)azepan-2-one |
|---|---|
| PubChem CID | 3844156 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-2-ylamino)azepan-2-one |
| SMILES | O=C1NCCCCC1NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H20N2O/c18-15-14(7-3-4-8-16-15)17-13-9-11-5-1-2-6-12(11)10-13/h1-2,5-6,13-14,17H,3-4,7-10H2,(H,16,18) |
| InChIKey | WCZQTRRXOVQQAY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |