C15H19N3O2 — CID 76887963
N-(2-oxoazepan-3-yl)-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 76887963) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is N-(2-oxoazepan-3-yl)-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-(2-oxoazepan-3-yl)-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 76887963 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-(2-oxoazepan-3-yl)-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | O=C1NCCCCC1NC(=O)C1Cc2ccccc2N1 |
| InChI | InChI=1S/C15H19N3O2/c19-14-12(7-3-4-8-16-14)18-15(20)13-9-10-5-1-2-6-11(10)17-13/h1-2,5-6,12-13,17H,3-4,7-9H2,(H,16,19)(H,18,20) |
| InChIKey | KQFKKYHRGHMTSC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |