C16H22N4O2 — CID 52991115
N-(2-oxoazepan-3-yl)-5-phenylpyrazolidine-3-carboxamide (PubChem CID 52991115) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is N-(2-oxoazepan-3-yl)-5-phenylpyrazolidine-3-carboxamide.
| Compound Name | N-(2-oxoazepan-3-yl)-5-phenylpyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 52991115 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | N-(2-oxoazepan-3-yl)-5-phenylpyrazolidine-3-carboxamide |
| SMILES | O=C(NC1CCCCNC1=O)C1CC(c2ccccc2)NN1 |
| InChI | InChI=1S/C16H22N4O2/c21-15-12(8-4-5-9-17-15)18-16(22)14-10-13(19-20-14)11-6-2-1-3-7-11/h1-3,6-7,12-14,19-20H,4-5,8-10H2,(H,17,21)(H,18,22) |
| InChIKey | RTQBIYNZSIHNQU-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |