C16H21N3O2 — CID 106901257
N-(2-oxoazepan-3-yl)-1,2,3,4-tetrahydroquinoline-3-carboxamide (PubChem CID 106901257) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-(2-oxoazepan-3-yl)-1,2,3,4-tetrahydroquinoline-3-carboxamide.
| Compound Name | N-(2-oxoazepan-3-yl)-1,2,3,4-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 106901257 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-(2-oxoazepan-3-yl)-1,2,3,4-tetrahydroquinoline-3-carboxamide |
| SMILES | O=C(NC1CCCCNC1=O)C1CNc2ccccc2C1 |
| InChI | InChI=1S/C16H21N3O2/c20-15(19-14-7-3-4-8-17-16(14)21)12-9-11-5-1-2-6-13(11)18-10-12/h1-2,5-6,12,14,18H,3-4,7-10H2,(H,17,21)(H,19,20) |
| InChIKey | TZFCIPHCEJVDCI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |