C17H23N3O — CID 61178008
(2S)-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 61178008) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is (2S)-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | (2S)-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 61178008 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | (2S)-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | O=C(NC1CCN2CCCCC12)[C@@H]1Cc2ccccc2N1 |
| InChI | InChI=1S/C17H23N3O/c21-17(15-11-12-5-1-2-6-13(12)18-15)19-14-8-10-20-9-4-3-7-16(14)20/h1-2,5-6,14-16,18H,3-4,7-11H2,(H,19,21)/t14?,15-,16?/m0/s1 |
| InChIKey | GQQRNPLUPKZQSN-PCKAHOCUSA-N |
| XLogP | 1.77 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |