C14H19N3O — CID 83020881
(2S)-N-piperidin-1-yl-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 83020881) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is (2S)-N-piperidin-1-yl-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | (2S)-N-piperidin-1-yl-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 83020881 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | (2S)-N-piperidin-1-yl-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | O=C(NN1CCCCC1)[C@@H]1Cc2ccccc2N1 |
| InChI | InChI=1S/C14H19N3O/c18-14(16-17-8-4-1-5-9-17)13-10-11-6-2-3-7-12(11)15-13/h2-3,6-7,13,15H,1,4-5,8-10H2,(H,16,18)/t13-/m0/s1 |
| InChIKey | IJLUEVUXODZIHU-ZDUSSCGKSA-N |
| XLogP | 1.54 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |