C38H50N6O5 — CID 154813242
N-benzyl-2-[(6S,11S,12R,18R,19S)-18-[(2-hydroxyphenyl)methylamino]-7,14,20-trioxo-2,8,15,21-tetrazapentacyclo[19.2.2.18,12.02,6.015,19]hexacosan-11-yl]acetamide (PubChem CID 154813242) has the molecular formula C38H50N6O5 and a molecular weight of 670.86 g/mol. Its IUPAC name is N-benzyl-2-[(6S,11S,12R,18R,19S)-18-[(2-hydroxyphenyl)methylamino]-7,14,20-trioxo-2,8,15,21-tetrazapentacyclo[19.2.2.18,12.02,6.015,19]hexacosan-11-yl]acetamide.
| Compound Name | N-benzyl-2-[(6S,11S,12R,18R,19S)-18-[(2-hydroxyphenyl)methylamino]-7,14,20-trioxo-2,8,15,21-tetrazapentacyclo[19.2.2.18,12.02,6.015,19]hexacosan-11-yl]acetamide |
|---|---|
| PubChem CID | 154813242 |
| Molecular Formula | C38H50N6O5 |
| Molecular Weight | 670.86 g/mol |
| Exact Mass | 670.38 |
| IUPAC Name | N-benzyl-2-[(6S,11S,12R,18R,19S)-18-[(2-hydroxyphenyl)methylamino]-7,14,20-trioxo-2,8,15,21-tetrazapentacyclo[19.2.2.18,12.02,6.015,19]hexacosan-11-yl]acetamide |
| SMILES | O=C(C[C@@H]1CCN2C[C@@H]1CC(=O)N1CC[C@@H](NCc3ccccc3O)[C@H]1C(=O)N1CCC(CC1)N1CCC[C@H]1C2=O)NCc1ccccc1 |
| InChI | InChI=1S/C38H50N6O5/c45-33-11-5-4-9-28(33)24-39-31-15-20-44-35(47)22-29-25-42(17-12-27(29)21-34(46)40-23-26-7-2-1-3-8-26)37(48)32-10-6-16-43(32)30-13-18-41(19-14-30)38(49)36(31)44/h1-5,7-9,11,27,29-32,36,39,45H,6,10,12-25H2,(H,40,46)/t27-,29-,31+,32-,36-/m0/s1 |
| InChIKey | YOJCQFHXBDEHBF-PCPZQQEMSA-N |
| XLogP | 2.48 |
| TPSA | 125.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.86 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|