C32H47N5O6 — CID 146116467
N-benzyl-2-[(1R,7R,8S,22S)-7-(cyclopentylamino)-3,9,18-trioxo-13,16-dioxa-4,10,19-triazatricyclo[17.3.1.04,8]tricosan-22-yl]acetamide (PubChem CID 146116467) has the molecular formula C32H47N5O6 and a molecular weight of 597.76 g/mol. Its IUPAC name is N-benzyl-2-[(1R,7R,8S,22S)-7-(cyclopentylamino)-3,9,18-trioxo-13,16-dioxa-4,10,19-triazatricyclo[17.3.1.04,8]tricosan-22-yl]acetamide.
| Compound Name | N-benzyl-2-[(1R,7R,8S,22S)-7-(cyclopentylamino)-3,9,18-trioxo-13,16-dioxa-4,10,19-triazatricyclo[17.3.1.04,8]tricosan-22-yl]acetamide |
|---|---|
| PubChem CID | 146116467 |
| Molecular Formula | C32H47N5O6 |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.35 |
| IUPAC Name | N-benzyl-2-[(1R,7R,8S,22S)-7-(cyclopentylamino)-3,9,18-trioxo-13,16-dioxa-4,10,19-triazatricyclo[17.3.1.04,8]tricosan-22-yl]acetamide |
| SMILES | O=C(C[C@@H]1CCN2C[C@@H]1CC(=O)N1CC[C@@H](NC3CCCC3)[C@H]1C(=O)NCCOCCOCC2=O)NCc1ccccc1 |
| InChI | InChI=1S/C32H47N5O6/c38-28(34-20-23-6-2-1-3-7-23)18-24-10-13-36-21-25(24)19-29(39)37-14-11-27(35-26-8-4-5-9-26)31(37)32(41)33-12-15-42-16-17-43-22-30(36)40/h1-3,6-7,24-27,31,35H,4-5,8-22H2,(H,33,41)(H,34,38)/t24-,25-,27+,31-/m0/s1 |
| InChIKey | RERKZBMVSTWCEN-LJQIRTBHSA-N |
| XLogP | 1.21 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |