C34H37N7O4 — CID 146117312
N-benzyl-2-[(1R,13R,18S)-13-[(1-benzyltriazol-4-yl)methyl]-11,14-dioxo-4-oxa-6,12,15-triazatricyclo[13.3.1.05,10]nonadeca-5(10),6,8-trien-18-yl]acetamide (PubChem CID 146117312) has the molecular formula C34H37N7O4 and a molecular weight of 607.72 g/mol. Its IUPAC name is N-benzyl-2-[(1R,13R,18S)-13-[(1-benzyltriazol-4-yl)methyl]-11,14-dioxo-4-oxa-6,12,15-triazatricyclo[13.3.1.05,10]nonadeca-5(10),6,8-trien-18-yl]acetamide.
| Compound Name | N-benzyl-2-[(1R,13R,18S)-13-[(1-benzyltriazol-4-yl)methyl]-11,14-dioxo-4-oxa-6,12,15-triazatricyclo[13.3.1.05,10]nonadeca-5(10),6,8-trien-18-yl]acetamide |
|---|---|
| PubChem CID | 146117312 |
| Molecular Formula | C34H37N7O4 |
| Molecular Weight | 607.72 g/mol |
| Exact Mass | 607.29 |
| IUPAC Name | N-benzyl-2-[(1R,13R,18S)-13-[(1-benzyltriazol-4-yl)methyl]-11,14-dioxo-4-oxa-6,12,15-triazatricyclo[13.3.1.05,10]nonadeca-5(10),6,8-trien-18-yl]acetamide |
| SMILES | O=C(C[C@@H]1CCN2C[C@@H]1CCOc1ncccc1C(=O)N[C@H](Cc1cn(Cc3ccccc3)nn1)C2=O)NCc1ccccc1 |
| InChI | InChI=1S/C34H37N7O4/c42-31(36-20-24-8-3-1-4-9-24)18-26-13-16-40-22-27(26)14-17-45-33-29(12-7-15-35-33)32(43)37-30(34(40)44)19-28-23-41(39-38-28)21-25-10-5-2-6-11-25/h1-12,15,23,26-27,30H,13-14,16-22H2,(H,36,42)(H,37,43)/t26-,27-,30+/m0/s1 |
| InChIKey | UFZQQCOJFOKPOG-FEVNIDIWSA-N |
| XLogP | 3.02 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.72 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |