C36H43N7O6 — CID 146117527
(3R)-18-[(2-methoxyphenyl)methyl]-3-[[1-(2-methoxyphenyl)triazol-4-yl]methyl]-12,15-dioxa-1,4,10,18-tetrazatricyclo[18.2.2.06,11]tetracosa-6(11),7,9-triene-2,5-dione (PubChem CID 146117527) has the molecular formula C36H43N7O6 and a molecular weight of 669.78 g/mol. Its IUPAC name is (3R)-18-[(2-methoxyphenyl)methyl]-3-[[1-(2-methoxyphenyl)triazol-4-yl]methyl]-12,15-dioxa-1,4,10,18-tetrazatricyclo[18.2.2.06,11]tetracosa-6(11),7,9-triene-2,5-dione.
| Compound Name | (3R)-18-[(2-methoxyphenyl)methyl]-3-[[1-(2-methoxyphenyl)triazol-4-yl]methyl]-12,15-dioxa-1,4,10,18-tetrazatricyclo[18.2.2.06,11]tetracosa-6(11),7,9-triene-2,5-dione |
|---|---|
| PubChem CID | 146117527 |
| Molecular Formula | C36H43N7O6 |
| Molecular Weight | 669.78 g/mol |
| Exact Mass | 669.33 |
| IUPAC Name | (3R)-18-[(2-methoxyphenyl)methyl]-3-[[1-(2-methoxyphenyl)triazol-4-yl]methyl]-12,15-dioxa-1,4,10,18-tetrazatricyclo[18.2.2.06,11]tetracosa-6(11),7,9-triene-2,5-dione |
| SMILES | COc1ccccc1CN1CCOCCOc2ncccc2C(=O)N[C@H](Cc2cn(-c3ccccc3OC)nn2)C(=O)N2CCC(CC2)C1 |
| InChI | InChI=1S/C36H43N7O6/c1-46-32-11-5-3-8-27(32)24-41-18-19-48-20-21-49-35-29(9-7-15-37-35)34(44)38-30(36(45)42-16-13-26(23-41)14-17-42)22-28-25-43(40-39-28)31-10-4-6-12-33(31)47-2/h3-12,15,25-26,30H,13-14,16-24H2,1-2H3,(H,38,44)/t30-/m1/s1 |
| InChIKey | SFBVFEWCNGIJTN-SSEXGKCCSA-N |
| XLogP | 3.17 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.78 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|