C26H36N4O4S — CID 146117555
(3R)-3-propyl-18-(thiophen-2-ylmethyl)-12,15-dioxa-1,4,10,18-tetrazatricyclo[18.2.2.06,11]tetracosa-6(11),7,9-triene-2,5-dione (PubChem CID 146117555) has the molecular formula C26H36N4O4S and a molecular weight of 500.67 g/mol. Its IUPAC name is (3R)-3-propyl-18-(thiophen-2-ylmethyl)-12,15-dioxa-1,4,10,18-tetrazatricyclo[18.2.2.06,11]tetracosa-6(11),7,9-triene-2,5-dione.
| Compound Name | (3R)-3-propyl-18-(thiophen-2-ylmethyl)-12,15-dioxa-1,4,10,18-tetrazatricyclo[18.2.2.06,11]tetracosa-6(11),7,9-triene-2,5-dione |
|---|---|
| PubChem CID | 146117555 |
| Molecular Formula | C26H36N4O4S |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | (3R)-3-propyl-18-(thiophen-2-ylmethyl)-12,15-dioxa-1,4,10,18-tetrazatricyclo[18.2.2.06,11]tetracosa-6(11),7,9-triene-2,5-dione |
| SMILES | CCC[C@H]1NC(=O)c2cccnc2OCCOCCN(Cc2cccs2)CC2CCN(CC2)C1=O |
| InChI | InChI=1S/C26H36N4O4S/c1-2-5-23-26(32)30-11-8-20(9-12-30)18-29(19-21-6-4-17-35-21)13-14-33-15-16-34-25-22(24(31)28-23)7-3-10-27-25/h3-4,6-7,10,17,20,23H,2,5,8-9,11-16,18-19H2,1H3,(H,28,31)/t23-/m1/s1 |
| InChIKey | WEUNYTXTRUQBMW-HSZRJFAPSA-N |
| XLogP | 3.19 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|